Dimethylaminoethylindane
2-(2,3-Dihydro-1H-inden-1-yl)-N,N-dimethylethan-1-amine
 9774 C13H19N 189.297
 InChI=1S/C13H19N/c1-14(2)10-9-12-8-7-11-5-3-4-6-13(11)12/h3-6,12H,7-10H2,1-2H3
 GUSRAZQUKLSRMX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCC1CCc2c1cccc2)C