4-(Naphthalen-1-yl)-1-propylpiperidine
 9719 C18H23N 253.382
 InChI=1S/C18H23N/c1-2-12-19-13-10-16(11-14-19)18-9-5-7-15-6-3-4-8-17(15)18/h3-9,16H,2,10-14H2,1H3
 ZEXVYCCERKFSCL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN1CCC(CC1)c1cccc2c1cccc2