2-EtO-N-Et-PEA
2-(2-Ethoxyphenyl)-N-ethylethan-1-amine
 9020 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-3-13-10-9-11-7-5-6-8-12(11)14-4-2/h5-8,13H,3-4,9-10H2,1-2H3
 CLEVTCSNQVRUNX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCc1ccccc1OCC