N-methyl-PCHA
N-Methyl-2-phenylcyclohexan-1-amine
 8663 C13H19N 189.297
 InChI=1S/C13H19N/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-4,7-8,12-14H,5-6,9-10H2,1H3
 MEBMVSVBSGKFAK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC1CCCCC1c1ccccc1