4-Cl-PPP
1-(4-Chlorophenyl)-2-(pyrrolidin-1-yl)propan-1-one
 8605 C13H16ClNO 237.725
 InChI=1S/C13H16ClNO/c1-10(15-8-2-3-9-15)13(16)11-4-6-12(14)7-5-11/h4-7,10H,2-3,8-9H2,1H3
 ULRSISQFKHWZNP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(=O)c1ccc(cc1)Cl)N1CCCC1