2,3-HMeMMA
2-[2-(Dimethylamino)propyl]-6-methylphenol
 6368 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9-6-5-7-11(12(9)14)8-10(2)13(3)4/h5-7,10,14H,8H2,1-4H3
 PTRBVIWYVUYQKX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1cccc(c1O)C)C)C