4-HePEA
2-(4-Hexylphenyl)ethan-1-amine
 6262 C14H23N 205.339
 InChI=1S/C14H23N/c1-2-3-4-5-6-13-7-9-14(10-8-13)11-12-15/h7-10H,2-6,11-12,15H2,1H3
 GPEIEKRQHRLDTB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCc1ccc(cc1)CCN