homo-N-Et-3-MPEA
N-Ethyl-3-(3-methoxyphenyl)propan-1-amine
 604 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-3-13-9-5-7-11-6-4-8-12(10-11)14-2/h4,6,8,10,13H,3,5,7,9H2,1-2H3
 DYURBMLUIAQWBD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCCc1cccc(c1)OC