pip-PEA
1-(2-Phenylethyl)piperidine
 6007 C13H19N 189.297
 InChI=1S/C13H19N/c1-3-7-13(8-4-1)9-12-14-10-5-2-6-11-14/h1,3-4,7-8H,2,5-6,9-12H2
 DBDVAKGHPZJLTH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1CCN(CC1)CCc1ccccc1