N-Ethylcypenamine
N-Ethyl-2-phenylcyclopentan-1-amine
 3339 C13H19N 189.297
 InChI=1S/C13H19N/c1-2-14-13-10-6-9-12(13)11-7-4-3-5-8-11/h3-5,7-8,12-14H,2,6,9-10H2,1H3
 VJENODZLGJCMFO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC1CCCC1c1ccccc1