4-Methyl-N-ethylnorephedrine
2-(Ethylamino)-1-(4-methylphenyl)propan-1-ol
 2997 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-13-10(3)12(14)11-7-5-9(2)6-8-11/h5-8,10,12-14H,4H2,1-3H3
 AQJDADTYOSUEIK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(C(c1ccc(cc1)C)O)C