1-Phenyl-N-(1-phenylethyl)propan-2-amine
 2756 C17H21N 239.355
 InChI=1S/C17H21N/c1-14(13-16-9-5-3-6-10-16)18-15(2)17-11-7-4-8-12-17/h3-12,14-15,18H,13H2,1-2H3
 DVWYTXULDUSWQH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC(c1ccccc1)C)Cc1ccccc1