N-Methylbenzedrone
2-[Benzyl(methyl)amino]-1-(4-methylphenyl)propan-1-one
 2698 C18H21NO 267.365
 InChI=1S/C18H21NO/c1-14-9-11-17(12-10-14)18(20)15(2)19(3)13-16-7-5-4-6-8-16/h4-12,15H,13H2,1-3H3
 UIOKRZKDMRJWFG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(C(=O)c1ccc(cc1)C)C)Cc1ccccc1