N,N-Dimethyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine
 1309 C13H19N 189.297
 InChI=1S/C13H19N/c1-14(2)13-9-5-8-11-6-3-4-7-12(11)10-13/h3-4,6-7,13H,5,8-10H2,1-2H3
 SPBHOHWGKSNKRC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C1CCCc2c(C1)cccc2)C