2-(Thiophen-3-yl)prop-2-en-1-amine
 10945 C7H9NS 139.218
 InChI=1S/C7H9NS/c1-6(4-8)7-2-3-9-5-7/h2-3,5H,1,4,8H2
 MJZFHGILSSSGFK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(=C)c1cscc1