2-(Thiophen-2-yl)prop-2-en-1-amine
 10942 C7H9NS 139.218
 InChI=1S/C7H9NS/c1-6(5-8)7-3-2-4-9-7/h2-4H,1,5,8H2
 BDANGHOEUJLGFD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(=C)c1cccs1