1-(Furan-2-yl)pentan-2-amine
 10938 C9H15NO 153.222
 InChI=1S/C9H15NO/c1-2-4-8(10)7-9-5-3-6-11-9/h3,5-6,8H,2,4,7,10H2,1H3
 XKAQEMMMHKFNCP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(Cc1ccco1)N