1-Phenylcyclopropan-1-amine
 10819 C9H11N 133.19
 InChI=1S/C9H11N/c10-9(6-7-9)8-4-2-1-3-5-8/h1-5H,6-7,10H2
 OYRBDGKUVUVWRI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1(CC1)c1ccccc1