1-Phenyl-N-(2-phenylethyl)butan-2-amine
 10772 C18H23N 253.382
 InChI=1S/C18H23N/c1-2-18(15-17-11-7-4-8-12-17)19-14-13-16-9-5-3-6-10-16/h3-12,18-19H,2,13-15H2,1H3
 OIWLZTNKGBUMNE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1ccccc1)NCCc1ccccc1