1,3-Diphenylpropan-2-amine
 10765 C15H17N 211.302
 InChI=1S/C15H17N/c16-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15H,11-12,16H2
 BWYYVSNVUCFQQN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC(Cc1ccccc1)Cc1ccccc1