N-Methyl-1-phenyl-N-(2-phenylethyl)propan-2-amine
 10704 C18H23N 253.382
 InChI=1S/C18H23N/c1-16(15-18-11-7-4-8-12-18)19(2)14-13-17-9-5-3-6-10-17/h3-12,16H,13-15H2,1-2H3
 GQJHAVHSZPQZHD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1ccccc1)C)CCc1ccccc1