(4E)-N-(2-Phenylethyl)-5-(pyridin-3-yl)pent-4-en-1-amine
 10690 C18H22N2 266.381
 InChI=1S/C18H22N2/c1-3-8-17(9-4-1)12-15-19-13-6-2-5-10-18-11-7-14-20-16-18/h1,3-5,7-11,14,16,19H,2,6,12-13,15H2/b10-5+
 DSUKBESLHOUBDY-BJMVGYQFSA-N This stereoisomer Any stereoisomer
 C(NCCc1ccccc1)CC/C=C/c1cccnc1