N-(Phenethyl)phenethylamine
2-Phenyl-N-(2-phenylethyl)ethan-1-amine
 10687 C16H19N 225.329
 InChI=1S/C16H19N/c1-3-7-15(8-4-1)11-13-17-14-12-16-9-5-2-6-10-16/h1-10,17H,11-14H2
 ACSAKRLPJQIBFB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N(CCc1ccccc1)CCc1ccccc1