N-(1-Phenylpropan-2-yl)aniline
 10672 C15H17N 211.302
 InChI=1S/C15H17N/c1-13(12-14-8-4-2-5-9-14)16-15-10-6-3-7-11-15/h2-11,13,16H,12H2,1H3
 RXBOKNNFSDKJDQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Nc1ccccc1)Cc1ccccc1