(2-Phenethyl)amphetamine
1-Phenyl-N-(2-phenylethyl)propan-2-amine
 10660 C17H21N 239.355
 InChI=1S/C17H21N/c1-15(14-17-10-6-3-7-11-17)18-13-12-16-8-4-2-5-9-16/h2-11,15,18H,12-14H2,1H3
 MRVIUBHXZKIUJZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCCc1ccccc1