Hexylamphetamine
N-(1-Phenylpropan-2-yl)hexan-1-amine
 10658 C15H25N 219.366
 InChI=1S/C15H25N/c1-3-4-5-9-12-16-14(2)13-15-10-7-6-8-11-15/h6-8,10-11,14,16H,3-5,9,12-13H2,1-2H3
 VTKHNKCOABPSKX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCNC(Cc1ccccc1)C