2-(Phenethyl)phenethylamine
2-[2-(2-Phenylethyl)phenyl]ethan-1-amine
 10637 C16H19N 225.329
 InChI=1S/C16H19N/c17-13-12-16-9-5-4-8-15(16)11-10-14-6-2-1-3-7-14/h1-9H,10-13,17H2
 BOMFJXWRNQCPKF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccccc1CCc1ccccc1