2-Methyl-6-{2-[(propan-2-yl)amino]ethyl}phenol
 10033 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9(2)13-8-7-11-6-4-5-10(3)12(11)14/h4-6,9,13-14H,7-8H2,1-3H3
 JNWBAFWRONJCLZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NCCc1cccc(c1O)C)C