MDA-NPI
N-[1-(2H-1,3-Benzodioxol-5-yl)propan-2-yl]propan-2-imine
 9580 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-9(2)14-10(3)6-11-4-5-12-13(7-11)16-8-15-12/h4-5,7,10H,6,8H2,1-3H3
 NZPORZIZMJOGMC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=NC(Cc1ccc2c(c1)OCO2)C)C