N-Acetyl-4-hydroxytryptamine
N-[2-(4-Hydroxy-1H-indol-3-yl)ethyl]acetamide
 8062  C12H14N2O2  218.252
 InChI=1S/C12H14N2O2/c1-8(15)13-6-5-9-7-14-10-3-2-4-11(16)12(9)10/h2-4,7,14,16H,5-6H2,1H3,(H,13,15)
 QPUGUOKMJGOSHT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=O)NCCc1c[nH]c2c1c(O)ccc2