DOMAD
5,8-Dimethoxy-6-methyl-1,2-dihydronaphthalen-2-amine
 7871 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-8-6-12(15-2)11-7-9(14)4-5-10(11)13(8)16-3/h4-6,9H,7,14H2,1-3H3
 KDQRIFZRBIPQEW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(c2c1CC(N)C=C2)OC