3,4,5-DOET
1-(3-Ethyl-4,5-dimethoxyphenyl)propan-2-amine
 7575 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-11-7-10(6-9(2)14)8-12(15-3)13(11)16-4/h7-9H,5-6,14H2,1-4H3
 VSTHMQUSIJIGMK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(CC)cc(cc1OC)CC(N)C