DMT-4,5-dione
3-[2-(Dimethylamino)ethyl]-1H-indole-4,5-dione
 6409  C12H14N2O2  218.252
 InChI=1S/C12H14N2O2/c1-14(2)6-5-8-7-13-9-3-4-10(15)12(16)11(8)9/h3-4,7,13H,5-6H2,1-2H3
 QKRMAGXFJVEVAD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c[nH]c2c1C(=O)C(=O)C=C2)C