5-DBFPV
1-(2,3-Dihydro-1-benzofuran-5-yl)-2-(pyrrolidin-1-yl)pentan-1-one
 609 C17H23NO2 273.37
 InChI=1S/C17H23NO2/c1-2-5-15(18-9-3-4-10-18)17(19)14-6-7-16-13(12-14)8-11-20-16/h6-7,12,15H,2-5,8-11H2,1H3
 CIGWUZUBQBQZAO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1ccc2c(c1)CCO2)N1CCCC1