Exploring 2327. To explore a different substance…

IUPAC name:
ID: 2327 · Formula: C20H27NO2 · Molecular weight: 313.434
InChI: InChI=1S/C20H27NO2/c1-22-19-15-18(12-13-21)20(23-2)14-17(19)11-7-6-10-16-8-4-3-5-9-16/h3-5,8-9,14-15H,6-7,10-13,21H2,1-2H3

Dowd, CS; Herrick-Davis, K; Egan, C; DuPre, A; Smith, C; Teitler, M; Glennon, RA. 1-[4-(3-Phenylalkyl)phenyl]-2-aminopropanes as 5-HT2A partial agonists. J. Med. Chem., 10 Aug 2000, 43 (16), 3074–3084. 271 kB. http://dx.doi.org/10.1021/jm9906062

Ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate
PiHKAL#20 2C-B; SI#18 2C-B
PiHKAL#22 2C-C; SI#19 2C-C
PiHKAL#23 2C-D; SI#20 2C-D
PiHKAL#24 2C-E; SI#21 2C-E
PiHKAL#26 2C-F
PiHKAL#32 2C-H; SI#22 2C-H
PiHKAL#33 2C-I; SI#23 2C-I
PiHKAL#34 2C-N
PiHKAL#35 2C-O-4
PiHKAL#36 2C-P
PiHKAL#39 2C-T; SI#25 2C-T
PiHKAL#40 2C-T-2; SI#26 2C-T-2
PiHKAL#41 2C-T-4
PiHKAL#43 2C-T-7; SI#27 2C-T-7
PiHKAL#44 2C-T-8
PiHKAL#45 2C-T-9
PiHKAL#46 2C-T-13
PiHKAL#47 2C-T-15
PiHKAL#48 2C-T-17
PiHKAL#49 2C-T-21
2C-CN; 2,5-Dimethoxy-4-cyanophenethylamine
2C-CA; 2,5-Dimethoxy-4-carboxyphenethylamine
2C-TFM; 4-Trifuouromethyl-2,5-dimethoxyphenethylamine
2C-O-2; 2,5-Dimethoxy-4-ethoxyphenethylamine
2C-O-7; 2,5-Dimethoxy-4-n-propoxyphenethylamine
2C-O-19; 2,5-Dimethoxy-4-n-butoxyphenethylamine
2C-SE-2; 2,5-Dimethoxy-4-ethylselenophenethylamine
2C-SE-4; 2,5-Dimethoxy-4-isopropylselenophenethylamine
2C-SE-7; 2,5-Dimethoxy-4-n-propylselenophenethylamine
2C-SE-21; 2,5-Dimethoxy-4-(2-fluoroethylseleno)phenethylamine
2C-TE; 2,5-Dimethoxy-4-methyltellurophenethylamine
2C-T-10; 2,5-Dimethoxy-4-(2-pyridylthio)phenethylamine
2C-T-11; 4-(4-Bromophenylthio)-2,5-dimethoxyphenethylamine
2C-T-12; 2,5-Dimethoxy-4-(1-morpholinothio)phenethylamine
2C-T-14; 2,5-Dimethoxy-4-(2-methylthioethylthio)phenethylamine
2C-T-5; 4-Cyclohexylthio-2,5-dimethoxyphenethylamine
2C-T-16; 4-Allylthio-2,5-dimethoxyphenethylamine
2C-T-6; 2,5-Dimethoxy-4-phenylthiophenethylamine
2C-T-19; 4-n-Butylthio-2,5-dimethoxyphenethylamine
2C-T-21.5; 4-(2,2-Difluouroethylthio)-2,5-dimethoxyphenethylamine
2C-T-22; 2,5-Dimethoxy-4-(2,2,2-trifluouroethylthio)phenethylamine
2C-T-18; 4-Cyclobutylthio-2,5-dimethoxyphenethylamine
2C-T-23; 4-Cyclopentylthio-2,5-dimethoxyamphetamine
2C-YN; 4-Ethynyl-2,5-dimethoxyphenethylamine
2C-pEtOH; 4-(2-Hydroxyethyl)-2,5-dimethoxyphenethylamine
2C-pKet; 4-Acetoxy-2,5-dimethoxyphenethylamine
2C-T-3; 4-Methallylthio-2,5-dimethoxyphenethylamine
2C-T-25; 4-Isobutylthio-2,5-dimethoxyphenethylamine
2C-T-27; 4-Benzylthio-2,5-dimethoxyphenethylamine
2C-T-28; 4-(3-Fluoropropylthio)-2,5-dimethoxyphenethylamine
2C-T-30; 4-(4-Fluorobutylthio)-2,5-dimethoxyphenethylamine
2C-T-31; 2,5-Dimethoxy-4-[4-(trifluoromethyl)benzylthio]phenethylamine
2C-T-32; 2,5-Dimethoxy-4-(2,3,4,5,6-pentafluorobenzylthio)phenethylamine
2C-T-33; 2,5-Dimethoxy-4-(3-methoxybenzylthio)phenethylamine
2C-VI; 4-Ethenyl-2,5-dimethoxyphenethylamine
2C-BI-1; 2,5-Dimethoxy-4-phenylphenethylamine
2C-BI-2; 2,5-Dimethoxy-4-(2-methoxyphenyl)phenethylamine
2C-BI-3; 2,5-Dimethoxy-4-(2-methylphenyl)phenethylamine
2C-BI-4; 2,5-Dimethoxy-4-[2-(trifluoromethyl)phenyl]phenethylamine
2C-BI-5; 2,5-Dimethoxy-4-(naphthalen-2-yl)phenethylamine
2C-BI-6; 2,5-Dimethoxy-4-(3-methoxyphenyl)phenethylamine
2C-BI-7; 2,5-Dimethoxy-4-(3-nitrophenyl)phenethylamine
2C-BI-8; 2,5-Dimethoxy-4-(4-methoxyphenyl)phenethylamine
2C-BI-9; 4-(4-Butylphenyl)-2,5-dimethoxyphenethylamine
2C-BI-10; 2,5-Dimethoxy-4-[4-(trifluoromethyl)phenyl]phenethylamine
2C-BI-11; 2,5-Dimethoxy-4-(4-phenylphenyl)phenethylamine
2C-BI-12; 2,5-Dimethoxy-4-(3,4-methylenedioxyphenyl)phenethylamine
2C-IP; Jelena
2C-EF; 4-(2-Fluoroethyl)-2,5-dimethoxyphenethylamine
2C-NH; 4-(2-Aminoethyl)-2,5-dimethoxyaniline
2C-HM; 4-(2-Aminoethyl)-2,5-dimethoxybenzaldehyde
2C-IB; 2-[2,5-Dimethoxy-4-(2-methylpropyl)phenyl]ethan-1-amine
2C-TFE; 2-[2,5-Dimethoxy-4-(2,2,2-trifluoroethyl)phenyl]ethan-1-amine
2C-O-22; 2-[2,5-Dimethoxy-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine
2C-O-21.5; 2-[4-(2,2-Difluoroethoxy)-2,5-dimethoxyphenyl]ethan-1-amine
2C-O-21; 2-[4-(2-Fluoroethoxy)-2,5-dimethoxyphenyl]ethan-1-amine
2C-A; 2,5-Dimethoxy-4-astatophenethylamine
4-PhBu-2-MPEA; 2-[2-Methoxy-4-(4-phenylbutyl)phenyl]ethan-1-amine
2C-BI-9; 4-(4-Butylphenyl)-2,5-dimethoxyphenethylamine
DOPh3; 2,5-Dimethoxy-4-phenylpropylamphetamine
Ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate
PiHKAL#20 2C-B; SI#18 2C-B
PiHKAL#22 2C-C; SI#19 2C-C
PiHKAL#23 2C-D; SI#20 2C-D
PiHKAL#24 2C-E; SI#21 2C-E
PiHKAL#26 2C-F
PiHKAL#32 2C-H; SI#22 2C-H
PiHKAL#33 2C-I; SI#23 2C-I
PiHKAL#34 2C-N
PiHKAL#35 2C-O-4
PiHKAL#36 2C-P
PiHKAL#39 2C-T; SI#25 2C-T
PiHKAL#40 2C-T-2; SI#26 2C-T-2
PiHKAL#41 2C-T-4
PiHKAL#43 2C-T-7; SI#27 2C-T-7
PiHKAL#44 2C-T-8
PiHKAL#45 2C-T-9
PiHKAL#46 2C-T-13
PiHKAL#47 2C-T-15
PiHKAL#48 2C-T-17
PiHKAL#49 2C-T-21
2C-CN; 2,5-Dimethoxy-4-cyanophenethylamine
2C-CA; 2,5-Dimethoxy-4-carboxyphenethylamine
2C-TFM; 4-Trifuouromethyl-2,5-dimethoxyphenethylamine
2C-O-2; 2,5-Dimethoxy-4-ethoxyphenethylamine
2C-O-7; 2,5-Dimethoxy-4-n-propoxyphenethylamine
2C-O-19; 2,5-Dimethoxy-4-n-butoxyphenethylamine
2C-SE-2; 2,5-Dimethoxy-4-ethylselenophenethylamine
2C-SE-4; 2,5-Dimethoxy-4-isopropylselenophenethylamine
2C-SE-7; 2,5-Dimethoxy-4-n-propylselenophenethylamine
2C-SE-21; 2,5-Dimethoxy-4-(2-fluoroethylseleno)phenethylamine
2C-TE; 2,5-Dimethoxy-4-methyltellurophenethylamine
2C-T-10; 2,5-Dimethoxy-4-(2-pyridylthio)phenethylamine
2C-T-11; 4-(4-Bromophenylthio)-2,5-dimethoxyphenethylamine
2C-T-12; 2,5-Dimethoxy-4-(1-morpholinothio)phenethylamine
2C-T-14; 2,5-Dimethoxy-4-(2-methylthioethylthio)phenethylamine
2C-T-5; 4-Cyclohexylthio-2,5-dimethoxyphenethylamine
2C-T-16; 4-Allylthio-2,5-dimethoxyphenethylamine
2C-T-6; 2,5-Dimethoxy-4-phenylthiophenethylamine
2C-T-19; 4-n-Butylthio-2,5-dimethoxyphenethylamine
2C-T-21.5; 4-(2,2-Difluouroethylthio)-2,5-dimethoxyphenethylamine
2C-T-22; 2,5-Dimethoxy-4-(2,2,2-trifluouroethylthio)phenethylamine
2C-T-18; 4-Cyclobutylthio-2,5-dimethoxyphenethylamine
2C-T-23; 4-Cyclopentylthio-2,5-dimethoxyamphetamine
2C-YN; 4-Ethynyl-2,5-dimethoxyphenethylamine
2C-pEtOH; 4-(2-Hydroxyethyl)-2,5-dimethoxyphenethylamine
2C-pKet; 4-Acetoxy-2,5-dimethoxyphenethylamine
2C-T-3; 4-Methallylthio-2,5-dimethoxyphenethylamine
2C-T-25; 4-Isobutylthio-2,5-dimethoxyphenethylamine
2C-T-27; 4-Benzylthio-2,5-dimethoxyphenethylamine
2C-T-28; 4-(3-Fluoropropylthio)-2,5-dimethoxyphenethylamine
2C-T-30; 4-(4-Fluorobutylthio)-2,5-dimethoxyphenethylamine
2C-T-31; 2,5-Dimethoxy-4-[4-(trifluoromethyl)benzylthio]phenethylamine
2C-T-32; 2,5-Dimethoxy-4-(2,3,4,5,6-pentafluorobenzylthio)phenethylamine
2C-T-33; 2,5-Dimethoxy-4-(3-methoxybenzylthio)phenethylamine
2C-VI; 4-Ethenyl-2,5-dimethoxyphenethylamine
2C-BI-1; 2,5-Dimethoxy-4-phenylphenethylamine
2C-BI-2; 2,5-Dimethoxy-4-(2-methoxyphenyl)phenethylamine
2C-BI-3; 2,5-Dimethoxy-4-(2-methylphenyl)phenethylamine
2C-BI-4; 2,5-Dimethoxy-4-[2-(trifluoromethyl)phenyl]phenethylamine
2C-BI-5; 2,5-Dimethoxy-4-(naphthalen-2-yl)phenethylamine