2,5-Dimethoxy-4-methyl-β-nitrostyrene
1,4-Dimethoxy-2-methyl-5-[(E)-2-nitroethenyl]benzene
 12386  C11H13NO4  223.225
 InChI=1S/C11H13NO4/c1-8-6-11(16-3)9(4-5-12(13)14)7-10(8)15-2/h4-7H,1-3H3/b5-4+
 QSLCRKSFTSEYDC-SNAWJCMRSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(cc1/C=C/N(=O)=O)OC