6-Me-TeMPEA
2-(2,3,4,5-Tetramethoxy-6-methylphenyl)ethan-1-amine
 10455  C13H21NO4  255.31
 InChI=1S/C13H21NO4/c1-8-9(6-7-14)11(16-3)13(18-5)12(17-4)10(8)15-2/h6-7,14H2,1-5H3
 BOXQLJMPRIMTOJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)c(OC)c(c(c1OC)OC)OC