2C-PYN
2-[2,5-Dimethoxy-4-(prop-1-yn-1-yl)phenyl]ethan-1-amine
 10310 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-4-5-10-8-13(16-3)11(6-7-14)9-12(10)15-2/h8-9H,6-7,14H2,1-3H3
 HWCIEWOPHKFODW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C#CC