ψ-DOC
1-(4-Chloro-2,6-dimethoxyphenyl)propan-2-amine
 10246  C11H16ClNO2  229.703
 InChI=1S/C11H16ClNO2/c1-7(13)4-9-10(14-2)5-8(12)6-11(9)15-3/h5-7H,4,13H2,1-3H3
 XRUUZIQSDVAFHL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Cl)cc(c1CC(N)C)OC