Pramiracetam
N-{2-[Di(propan-2-yl)amino]ethyl}-2-(2-oxopyrrolidin-1-yl)acetamide
 9986 C14H27N3O2 269.383
 InChI=1S/C14H27N3O2/c1-11(2)17(12(3)4)9-7-15-13(18)10-16-8-5-6-14(16)19/h11-12H,5-10H2,1-4H3,(H,15,18)
 ZULJGOSFKWFVRX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(CN1CCCC1=O)NCCN(C(C)C)C(C)C