Coluracetam
N-(2,3-Dimethyl-5,6,7,8-tetrahydrofuro[2,3-b]quinolin-4-yl)-2-(2-oxopyrrolidin-1-yl)acetamide
 9971 C19H23N3O3 341.404
 InChI=1S/C19H23N3O3/c1-11-12(2)25-19-17(11)18(13-6-3-4-7-14(13)20-19)21-15(23)10-22-9-5-8-16(22)24/h3-10H2,1-2H3,(H,20,21,23)
 PSPGQHXMUKWNDI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(Nc1c2CCCCc2nc2c1c(C)c(o2)C)CN1CCCC1=O