Secobarbital
5-(Pentan-2-yl)-5-(prop-2-en-1-yl)-1,3-diazinane-2,4,6-trione
 3992 C12H18N2O3 238.283
 InChI=1S/C12H18N2O3/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17)
 KQPKPCNLIDLUMF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C1(CC=C)C(=O)NC(=O)NC1=O)C