Clonidine
N-(2,6-Dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine
 3717 C9H9Cl2N3 230.094
 InChI=1S/C9H9Cl2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14)
 GJSURZIOUXUGAL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Clc1cccc(c1NC1=NCCN1)Cl