Modafinil
2-(Diphenylmethanesulfinyl)acetamide
 2978 C15H15NO2S 273.35
 InChI=1S/C15H15NO2S/c16-14(17)11-19(18)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,16,17)
 YFGHCGITMMYXAQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC(=O)CS(=O)C(c1ccccc1)c1ccccc1