Pregabalin
3-(Aminomethyl)-5-methylhexanoic acid
 1909  C8H17NO2  159.226
 InChI=1S/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)
 AYXYPKUFHZROOJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(CC(=O)O)CC(C)C