Propylhexedrine
1-Cyclohexyl-N-methylpropan-2-amine
 12167 C10H21N 155.28
 InChI=1S/C10H21N/c1-9(11-2)8-10-6-4-3-5-7-10/h9-11H,3-8H2,1-2H3
 JCRIVQIOJSSCQD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(CC1CCCCC1)C