Fasoracetam
(5R)-5-(Piperidine-1-carbonyl)pyrrolidin-2-one
 9977 C10H16N2O2 196.246
 InChI=1S/C10H16N2O2/c13-9-5-4-8(11-9)10(14)12-6-2-1-3-7-12/h8H,1-7H2,(H,11,13)/t8-/m1/s1
 GOWRRBABHQUJMX-MRVPVSSYSA-N This stereoisomer Any stereoisomer
 O=C1CC[C@@H](N1)C(=O)N1CCCCC1