N,N-Dimethyl-3-TFMA
N,N-Dimethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine
 9851  C12H16F3N  231.257
 InChI=1S/C12H16F3N/c1-9(16(2)3)7-10-5-4-6-11(8-10)12(13,14)15/h4-6,8-9H,7H2,1-3H3
 WLLQUCUAFUGKTR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1cccc(c1)C(F)(F)F)C)C