N-Methyl-N-[(oxolan-2-yl)methyl]-1-phenylpropan-2-amine
 9832 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-13(11-14-7-4-3-5-8-14)16(2)12-15-9-6-10-17-15/h3-5,7-8,13,15H,6,9-12H2,1-2H3
 LGBDRDSBJJEMCA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1ccccc1)C)CC1CCCO1