N-[(Oxolan-2-yl)methyl]-1-phenylpropan-2-amine
 9831 C14H21NO 219.323
 InChI=1S/C14H21NO/c1-12(10-13-6-3-2-4-7-13)15-11-14-8-5-9-16-14/h2-4,6-7,12,14-15H,5,8-11H2,1H3
 CQDTWANCCKRJEC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCC1CCCO1